About (5Z)-6,7-di(propan-2-yl)-3,4-dihydro-2H-1-benzoxocine
(5Z)-6,7-di(propan-2-yl)-3,4-dihydro-2H-1-benzoxocine (PubChem CID 170669014) has the molecular formula C17H24O
and a molecular weight of 244.38 g/mol. Its IUPAC name is (5Z)-6,7-di(propan-2-yl)-3,4-dihydro-2H-1-benzoxocine.
Molecular Properties
| Compound Name | (5Z)-6,7-di(propan-2-yl)-3,4-dihydro-2H-1-benzoxocine |
| PubChem CID | 170669014 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (5Z)-6,7-di(propan-2-yl)-3,4-dihydro-2H-1-benzoxocine |
| SMILES | CC(C)/C1=C/CCCOc2cccc(C(C)C)c21 |
| InChI | InChI=1S/C17H24O/c1-12(2)14-8-5-6-11-18-16-10-7-9-15(13(3)4)17(14)16/h7-10,12-13H,5-6,11H2,1-4H3/b14-8- |
| InChIKey | OWXYWBIBGBBKQU-ZSOIEALJSA-N |
| XLogP | 5.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5Z)-6,7-di(propan-2-yl)-3,4-dihydro-2H-1-benzoxocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-6,7-di(propan-2-yl)-3,4-dihydro-2H-1-benzoxocine?
The IUPAC name of (5Z)-6,7-di(propan-2-yl)-3,4-dihydro-2H-1-benzoxocine (CID 170669014) is (5Z)-6,7-di(propan-2-yl)-3,4-dihydro-2H-1-benzoxocine.
What is the SMILES notation for (5Z)-6,7-di(propan-2-yl)-3,4-dihydro-2H-1-benzoxocine?
The canonical SMILES for (5Z)-6,7-di(propan-2-yl)-3,4-dihydro-2H-1-benzoxocine is CC(C)/C1=C/CCCOc2cccc(C(C)C)c21.
What is the InChIKey of (5Z)-6,7-di(propan-2-yl)-3,4-dihydro-2H-1-benzoxocine?
The InChIKey is OWXYWBIBGBBKQU-ZSOIEALJSA-N. The full InChI is InChI=1S/C17H24O/c1-12(2)14-8-5-6-11-18-16-10-7-9-15(13(3)4)17(14)16/h7-10,12-13H,5-6,11H2,1-4H3/b14-8-.
What are the key properties of (5Z)-6,7-di(propan-2-yl)-3,4-dihydro-2H-1-benzoxocine?
(5Z)-6,7-di(propan-2-yl)-3,4-dihydro-2H-1-benzoxocine has a molecular weight of 244.38 g/mol, XLogP of 5.02, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-6,7-di(propan-2-yl)-3,4-dihydro-2H-1-benzoxocine is sourced from PubChem (CID 170669014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).