About 4,5-di(propan-2-yl)-1,6-naphthyridine
4,5-di(propan-2-yl)-1,6-naphthyridine (PubChem CID 170669371) has the molecular formula C14H18N2
and a molecular weight of 214.31 g/mol. Its IUPAC name is 4,5-di(propan-2-yl)-1,6-naphthyridine.
Molecular Properties
| Compound Name | 4,5-di(propan-2-yl)-1,6-naphthyridine |
| PubChem CID | 170669371 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 4,5-di(propan-2-yl)-1,6-naphthyridine |
| SMILES | CC(C)c1ccnc2ccnc(C(C)C)c12 |
| InChI | InChI=1S/C14H18N2/c1-9(2)11-5-7-15-12-6-8-16-14(10(3)4)13(11)12/h5-10H,1-4H3 |
| InChIKey | JDNQIAFRRKQAFC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-di(propan-2-yl)-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-di(propan-2-yl)-1,6-naphthyridine?
The IUPAC name of 4,5-di(propan-2-yl)-1,6-naphthyridine (CID 170669371) is 4,5-di(propan-2-yl)-1,6-naphthyridine.
What is the SMILES notation for 4,5-di(propan-2-yl)-1,6-naphthyridine?
The canonical SMILES for 4,5-di(propan-2-yl)-1,6-naphthyridine is CC(C)c1ccnc2ccnc(C(C)C)c12.
What is the InChIKey of 4,5-di(propan-2-yl)-1,6-naphthyridine?
The InChIKey is JDNQIAFRRKQAFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2/c1-9(2)11-5-7-15-12-6-8-16-14(10(3)4)13(11)12/h5-10H,1-4H3.
What are the key properties of 4,5-di(propan-2-yl)-1,6-naphthyridine?
4,5-di(propan-2-yl)-1,6-naphthyridine has a molecular weight of 214.31 g/mol, XLogP of 3.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-di(propan-2-yl)-1,6-naphthyridine is sourced from PubChem (CID 170669371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).