C18H14F3N3O3 — CID 170672225
1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-3-[5-[2-(trifluoromethyl)phenyl]pyrazin-2-yl]prop-2-yn-1-one (PubChem CID 170672225) has the molecular formula C18H14F3N3O3 and a molecular weight of 377.32 g/mol. Its IUPAC name is 1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-3-[5-[2-(trifluoromethyl)phenyl]pyrazin-2-yl]prop-2-yn-1-one.
| Compound Name | 1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-3-[5-[2-(trifluoromethyl)phenyl]pyrazin-2-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 170672225 |
| Molecular Formula | C18H14F3N3O3 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-3-[5-[2-(trifluoromethyl)phenyl]pyrazin-2-yl]prop-2-yn-1-one |
| SMILES | O=C(C#Cc1cnc(-c2ccccc2C(F)(F)F)cn1)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C18H14F3N3O3/c19-18(20,21)13-4-2-1-3-12(13)14-8-22-11(7-23-14)5-6-17(27)24-9-15(25)16(26)10-24/h1-4,7-8,15-16,25-26H,9-10H2/t15-,16+ |
| InChIKey | VHXLANMYLWMHPR-IYBDPMFKSA-N |
| XLogP | 1.08 |
| TPSA | 86.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|