C44H29N9O6S3 — CID 170672458
4-[[5-cyano-3-[[3-cyano-4-naphthalen-2-yl-5-(naphthalen-2-yldiazenyl)thiophen-2-yl]diazenyl]-4-methyl-6-(4-sulfoanilino)-2-pyridinyl]amino]benzenesulfonic acid (PubChem CID 170672458) has the molecular formula C44H29N9O6S3 and a molecular weight of 875.97 g/mol. Its IUPAC name is 4-[[5-cyano-3-[[3-cyano-4-naphthalen-2-yl-5-(naphthalen-2-yldiazenyl)thiophen-2-yl]diazenyl]-4-methyl-6-(4-sulfoanilino)-2-pyridinyl]amino]benzenesulfonic acid.
| Compound Name | 4-[[5-cyano-3-[[3-cyano-4-naphthalen-2-yl-5-(naphthalen-2-yldiazenyl)thiophen-2-yl]diazenyl]-4-methyl-6-(4-sulfoanilino)-2-pyridinyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 170672458 |
| Molecular Formula | C44H29N9O6S3 |
| Molecular Weight | 875.97 g/mol |
| Exact Mass | 875.14 |
| IUPAC Name | 4-[[5-cyano-3-[[3-cyano-4-naphthalen-2-yl-5-(naphthalen-2-yldiazenyl)thiophen-2-yl]diazenyl]-4-methyl-6-(4-sulfoanilino)-2-pyridinyl]amino]benzenesulfonic acid |
| SMILES | Cc1c(C#N)c(Nc2ccc(S(=O)(=O)O)cc2)nc(Nc2ccc(S(=O)(=O)O)cc2)c1/N=N/c1sc(/N=N/c2ccc3ccccc3c2)c(-c2ccc3ccccc3c2)c1C#N |
| InChI | InChI=1S/C44H29N9O6S3/c1-26-37(24-45)41(47-32-14-18-35(19-15-32)61(54,55)56)49-42(48-33-16-20-36(21-17-33)62(57,58)59)40(26)51-52-43-38(25-46)39(31-11-10-27-6-2-4-8-29(27)22-31)44(60-43)53-50-34-13-12-28-7-3-5-9-30(28)23-34/h2-23H,1H3,(H2,47,48,49)(H,54,55,56)(H,57,58,59)/b52-51+,53-50+ |
| InChIKey | LBUXTSOTXHTVFK-GJSDQHKISA-N |
| XLogP | 11.98 |
| TPSA | 242.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.97 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|