C25H24N4 — CID 170672545
5-tert-butyl-14-(2,6-dimethylphenyl)-4,6,14,17-tetrazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2,4,6,8,10,12,15-octaene (PubChem CID 170672545) has the molecular formula C25H24N4 and a molecular weight of 380.50 g/mol. Its IUPAC name is 5-tert-butyl-14-(2,6-dimethylphenyl)-4,6,14,17-tetrazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2,4,6,8,10,12,15-octaene.
| Compound Name | 5-tert-butyl-14-(2,6-dimethylphenyl)-4,6,14,17-tetrazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2,4,6,8,10,12,15-octaene |
|---|---|
| PubChem CID | 170672545 |
| Molecular Formula | C25H24N4 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 5-tert-butyl-14-(2,6-dimethylphenyl)-4,6,14,17-tetrazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2,4,6,8,10,12,15-octaene |
| SMILES | Cc1cccc(C)c1-n1ccc2c3ccc4nc(C(C)(C)C)ncc4c3ncc21 |
| InChI | InChI=1S/C25H24N4/c1-15-7-6-8-16(2)23(15)29-12-11-17-18-9-10-20-19(22(18)26-14-21(17)29)13-27-24(28-20)25(3,4)5/h6-14H,1-5H3 |
| InChIKey | QHJUYWTXKVCWRP-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|