About 6-amino-5-aminooxy-1,3-diethylpyrimidine-2,4-dione
6-amino-5-aminooxy-1,3-diethylpyrimidine-2,4-dione (PubChem CID 170672731) has the molecular formula C8H14N4O3
and a molecular weight of 214.22 g/mol. Its IUPAC name is 6-amino-5-aminooxy-1,3-diethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-amino-5-aminooxy-1,3-diethylpyrimidine-2,4-dione |
| PubChem CID | 170672731 |
| Molecular Formula | C8H14N4O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 6-amino-5-aminooxy-1,3-diethylpyrimidine-2,4-dione |
| SMILES | CCn1c(N)c(ON)c(=O)n(CC)c1=O |
| InChI | InChI=1S/C8H14N4O3/c1-3-11-6(9)5(15-10)7(13)12(4-2)8(11)14/h3-4,9-10H2,1-2H3 |
| InChIKey | ZYIVFLQCRCYGIR-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-5-aminooxy-1,3-diethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-aminooxy-1,3-diethylpyrimidine-2,4-dione?
The IUPAC name of 6-amino-5-aminooxy-1,3-diethylpyrimidine-2,4-dione (CID 170672731) is 6-amino-5-aminooxy-1,3-diethylpyrimidine-2,4-dione.
What is the SMILES notation for 6-amino-5-aminooxy-1,3-diethylpyrimidine-2,4-dione?
The canonical SMILES for 6-amino-5-aminooxy-1,3-diethylpyrimidine-2,4-dione is CCn1c(N)c(ON)c(=O)n(CC)c1=O.
What is the InChIKey of 6-amino-5-aminooxy-1,3-diethylpyrimidine-2,4-dione?
The InChIKey is ZYIVFLQCRCYGIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O3/c1-3-11-6(9)5(15-10)7(13)12(4-2)8(11)14/h3-4,9-10H2,1-2H3.
What are the key properties of 6-amino-5-aminooxy-1,3-diethylpyrimidine-2,4-dione?
6-amino-5-aminooxy-1,3-diethylpyrimidine-2,4-dione has a molecular weight of 214.22 g/mol, XLogP of -1.12, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-aminooxy-1,3-diethylpyrimidine-2,4-dione is sourced from PubChem (CID 170672731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).