C34H28N8O — CID 170673190
4-[2-(4-aminophenyl)ethynyl]-2-[3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-1H-indol-7-yl]-3H-isoindol-1-one (PubChem CID 170673190) has the molecular formula C34H28N8O and a molecular weight of 564.65 g/mol. Its IUPAC name is 4-[2-(4-aminophenyl)ethynyl]-2-[3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-1H-indol-7-yl]-3H-isoindol-1-one.
| Compound Name | 4-[2-(4-aminophenyl)ethynyl]-2-[3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-1H-indol-7-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 170673190 |
| Molecular Formula | C34H28N8O |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 4-[2-(4-aminophenyl)ethynyl]-2-[3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-1H-indol-7-yl]-3H-isoindol-1-one |
| SMILES | Cc1cnc(Nc2cc(C)n(C)n2)nc1-c1c[nH]c2c(N3Cc4c(C#Cc5ccc(N)cc5)cccc4C3=O)cccc12 |
| InChI | InChI=1S/C34H28N8O/c1-20-17-37-34(38-30-16-21(2)41(3)40-30)39-31(20)27-18-36-32-25(27)7-5-9-29(32)42-19-28-23(6-4-8-26(28)33(42)43)13-10-22-11-14-24(35)15-12-22/h4-9,11-12,14-18,36H,19,35H2,1-3H3,(H,37,38,39,40) |
| InChIKey | IYXRWTUKUIIYNU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|