C26H21N7O3 — CID 170673248
2-[3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-1H-indol-7-yl]-4-hydroxyisoindole-1,3-dione (PubChem CID 170673248) has the molecular formula C26H21N7O3 and a molecular weight of 479.50 g/mol. Its IUPAC name is 2-[3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-1H-indol-7-yl]-4-hydroxyisoindole-1,3-dione.
| Compound Name | 2-[3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-1H-indol-7-yl]-4-hydroxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 170673248 |
| Molecular Formula | C26H21N7O3 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 2-[3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-1H-indol-7-yl]-4-hydroxyisoindole-1,3-dione |
| SMILES | Cc1cnc(Nc2cc(C)n(C)n2)nc1-c1c[nH]c2c(N3C(=O)c4cccc(O)c4C3=O)cccc12 |
| InChI | InChI=1S/C26H21N7O3/c1-13-11-28-26(29-20-10-14(2)32(3)31-20)30-22(13)17-12-27-23-15(17)6-4-8-18(23)33-24(35)16-7-5-9-19(34)21(16)25(33)36/h4-12,27,34H,1-3H3,(H,28,29,30,31) |
| InChIKey | NBRABIURZKMYQA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|