C21H27N7O8PS- — CID 170673655
1-[(2R,5S)-5-[[[(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-ethyloxolan-3-yl]oxy-oxidophosphinothioyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 170673655) has the molecular formula C21H27N7O8PS- and a molecular weight of 568.53 g/mol. Its IUPAC name is 1-[(2R,5S)-5-[[[(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-ethyloxolan-3-yl]oxy-oxidophosphinothioyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-5-[[[(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-ethyloxolan-3-yl]oxy-oxidophosphinothioyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170673655 |
| Molecular Formula | C21H27N7O8PS- |
| Molecular Weight | 568.53 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | 1-[(2R,5S)-5-[[[(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-ethyloxolan-3-yl]oxy-oxidophosphinothioyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)C[C@H]1OP([O-])(=S)OC[C@@H]1CC[C@H](n2cc(C)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C21H28N7O8PS/c1-3-12-13(6-15(35-12)28-9-23-16-17(28)24-20(22)25-19(16)30)36-37(32,38)33-8-11-4-5-14(34-11)27-7-10(2)18(29)26-21(27)31/h7,9,11-15H,3-6,8H2,1-2H3,(H,32,38)(H,26,29,31)(H3,22,24,25,30)/p-1/t11-,12+,13+,14+,15+,37?/m0/s1 |
| InChIKey | DIKQDTOZUNPNDE-BSYBNEFZSA-M |
| XLogP | -0.08 |
| TPSA | 204.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.53 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|