About 4-(2,4-dimethoxyphenyl)-2-morpholin-4-ylindeno[1,2-d]pyrimidin-5-one
4-(2,4-dimethoxyphenyl)-2-morpholin-4-ylindeno[1,2-d]pyrimidin-5-one (PubChem CID 17067390) has the molecular formula C23H21N3O4
and a molecular weight of 403.44 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-2-morpholin-4-ylindeno[1,2-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 4-(2,4-dimethoxyphenyl)-2-morpholin-4-ylindeno[1,2-d]pyrimidin-5-one |
| PubChem CID | 17067390 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-2-morpholin-4-ylindeno[1,2-d]pyrimidin-5-one |
| SMILES | COc1ccc(-c2nc(N3CCOCC3)nc3c2C(=O)c2ccccc2-3)c(OC)c1 |
| InChI | InChI=1S/C23H21N3O4/c1-28-14-7-8-17(18(13-14)29-2)21-19-20(15-5-3-4-6-16(15)22(19)27)24-23(25-21)26-9-11-30-12-10-26/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | DKFXFWOSCIRVDZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(2,4-dimethoxyphenyl)-2-morpholin-4-ylindeno[1,2-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dimethoxyphenyl)-2-morpholin-4-ylindeno[1,2-d]pyrimidin-5-one?
The IUPAC name of 4-(2,4-dimethoxyphenyl)-2-morpholin-4-ylindeno[1,2-d]pyrimidin-5-one (CID 17067390) is 4-(2,4-dimethoxyphenyl)-2-morpholin-4-ylindeno[1,2-d]pyrimidin-5-one.
What is the SMILES notation for 4-(2,4-dimethoxyphenyl)-2-morpholin-4-ylindeno[1,2-d]pyrimidin-5-one?
The canonical SMILES for 4-(2,4-dimethoxyphenyl)-2-morpholin-4-ylindeno[1,2-d]pyrimidin-5-one is COc1ccc(-c2nc(N3CCOCC3)nc3c2C(=O)c2ccccc2-3)c(OC)c1.
What is the InChIKey of 4-(2,4-dimethoxyphenyl)-2-morpholin-4-ylindeno[1,2-d]pyrimidin-5-one?
The InChIKey is DKFXFWOSCIRVDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N3O4/c1-28-14-7-8-17(18(13-14)29-2)21-19-20(15-5-3-4-6-16(15)22(19)27)24-23(25-21)26-9-11-30-12-10-26/h3-8,13H,9-12H2,1-2H3.
What are the key properties of 4-(2,4-dimethoxyphenyl)-2-morpholin-4-ylindeno[1,2-d]pyrimidin-5-one?
4-(2,4-dimethoxyphenyl)-2-morpholin-4-ylindeno[1,2-d]pyrimidin-5-one has a molecular weight of 403.44 g/mol, XLogP of 3.21, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dimethoxyphenyl)-2-morpholin-4-ylindeno[1,2-d]pyrimidin-5-one is sourced from PubChem (CID 17067390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).