C38H40O4 — CID 170673921
[(1S,4S)-1-methyl-4-(2-methylphenyl)-3-(2,4,6-trimethylbenzoyl)oxy-1,2,3,4-tetrahydronaphthalen-2-yl] 2,4,6-trimethylbenzoate (PubChem CID 170673921) has the molecular formula C38H40O4 and a molecular weight of 560.73 g/mol. Its IUPAC name is [(1S,4S)-1-methyl-4-(2-methylphenyl)-3-(2,4,6-trimethylbenzoyl)oxy-1,2,3,4-tetrahydronaphthalen-2-yl] 2,4,6-trimethylbenzoate.
| Compound Name | [(1S,4S)-1-methyl-4-(2-methylphenyl)-3-(2,4,6-trimethylbenzoyl)oxy-1,2,3,4-tetrahydronaphthalen-2-yl] 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 170673921 |
| Molecular Formula | C38H40O4 |
| Molecular Weight | 560.73 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | [(1S,4S)-1-methyl-4-(2-methylphenyl)-3-(2,4,6-trimethylbenzoyl)oxy-1,2,3,4-tetrahydronaphthalen-2-yl] 2,4,6-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OC2C(OC(=O)c3c(C)cc(C)cc3C)[C@@H](C)c3ccccc3[C@@H]2c2ccccc2C)c(C)c1 |
| InChI | InChI=1S/C38H40O4/c1-21-17-24(4)32(25(5)18-21)37(39)41-35-28(8)30-15-11-12-16-31(30)34(29-14-10-9-13-23(29)3)36(35)42-38(40)33-26(6)19-22(2)20-27(33)7/h9-20,28,34-36H,1-8H3/t28-,34-,35?,36?/m0/s1 |
| InChIKey | ODWOTICTULMIPI-BOXDMETGSA-N |
| XLogP | 8.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.73 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |