About [10-(1H-pyrrole-2-carbonyloxy)-9-tricyclo[6.2.1.02,7]undecanyl] 1H-pyrrole-2-carboxylate
[10-(1H-pyrrole-2-carbonyloxy)-9-tricyclo[6.2.1.02,7]undecanyl] 1H-pyrrole-2-carboxylate (PubChem CID 170674267) has the molecular formula C21H24N2O4
and a molecular weight of 368.43 g/mol. Its IUPAC name is [10-(1H-pyrrole-2-carbonyloxy)-9-tricyclo[6.2.1.02,7]undecanyl] 1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | [10-(1H-pyrrole-2-carbonyloxy)-9-tricyclo[6.2.1.02,7]undecanyl] 1H-pyrrole-2-carboxylate |
| PubChem CID | 170674267 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | [10-(1H-pyrrole-2-carbonyloxy)-9-tricyclo[6.2.1.02,7]undecanyl] 1H-pyrrole-2-carboxylate |
| SMILES | O=C(OC1C2CC(C3CCCCC32)C1OC(=O)c1ccc[nH]1)c1ccc[nH]1 |
| InChI | InChI=1S/C21H24N2O4/c24-20(16-7-3-9-22-16)26-18-14-11-15(13-6-2-1-5-12(13)14)19(18)27-21(25)17-8-4-10-23-17/h3-4,7-10,12-15,18-19,22-23H,1-2,5-6,11H2 |
| InChIKey | FIVZNBAOMZRNQZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [10-(1H-pyrrole-2-carbonyloxy)-9-tricyclo[6.2.1.02,7]undecanyl] 1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [10-(1H-pyrrole-2-carbonyloxy)-9-tricyclo[6.2.1.02,7]undecanyl] 1H-pyrrole-2-carboxylate?
The IUPAC name of [10-(1H-pyrrole-2-carbonyloxy)-9-tricyclo[6.2.1.02,7]undecanyl] 1H-pyrrole-2-carboxylate (CID 170674267) is [10-(1H-pyrrole-2-carbonyloxy)-9-tricyclo[6.2.1.02,7]undecanyl] 1H-pyrrole-2-carboxylate.
What is the SMILES notation for [10-(1H-pyrrole-2-carbonyloxy)-9-tricyclo[6.2.1.02,7]undecanyl] 1H-pyrrole-2-carboxylate?
The canonical SMILES for [10-(1H-pyrrole-2-carbonyloxy)-9-tricyclo[6.2.1.02,7]undecanyl] 1H-pyrrole-2-carboxylate is O=C(OC1C2CC(C3CCCCC32)C1OC(=O)c1ccc[nH]1)c1ccc[nH]1.
What is the InChIKey of [10-(1H-pyrrole-2-carbonyloxy)-9-tricyclo[6.2.1.02,7]undecanyl] 1H-pyrrole-2-carboxylate?
The InChIKey is FIVZNBAOMZRNQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O4/c24-20(16-7-3-9-22-16)26-18-14-11-15(13-6-2-1-5-12(13)14)19(18)27-21(25)17-8-4-10-23-17/h3-4,7-10,12-15,18-19,22-23H,1-2,5-6,11H2.
What are the key properties of [10-(1H-pyrrole-2-carbonyloxy)-9-tricyclo[6.2.1.02,7]undecanyl] 1H-pyrrole-2-carboxylate?
[10-(1H-pyrrole-2-carbonyloxy)-9-tricyclo[6.2.1.02,7]undecanyl] 1H-pyrrole-2-carboxylate has a molecular weight of 368.43 g/mol, XLogP of 3.55, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [10-(1H-pyrrole-2-carbonyloxy)-9-tricyclo[6.2.1.02,7]undecanyl] 1H-pyrrole-2-carboxylate is sourced from PubChem (CID 170674267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).