C26H20Cl2N6O5 — CID 170674564
ethyl N-[2-cyano-2-[[3,5-dichloro-4-[(1-oxo-2-pyridin-3-yl-3,4-dihydroisoquinolin-6-yl)oxy]phenyl]hydrazinylidene]acetyl]carbamate (PubChem CID 170674564) has the molecular formula C26H20Cl2N6O5 and a molecular weight of 567.39 g/mol. Its IUPAC name is ethyl N-[2-cyano-2-[[3,5-dichloro-4-[(1-oxo-2-pyridin-3-yl-3,4-dihydroisoquinolin-6-yl)oxy]phenyl]hydrazinylidene]acetyl]carbamate.
| Compound Name | ethyl N-[2-cyano-2-[[3,5-dichloro-4-[(1-oxo-2-pyridin-3-yl-3,4-dihydroisoquinolin-6-yl)oxy]phenyl]hydrazinylidene]acetyl]carbamate |
|---|---|
| PubChem CID | 170674564 |
| Molecular Formula | C26H20Cl2N6O5 |
| Molecular Weight | 567.39 g/mol |
| Exact Mass | 566.09 |
| IUPAC Name | ethyl N-[2-cyano-2-[[3,5-dichloro-4-[(1-oxo-2-pyridin-3-yl-3,4-dihydroisoquinolin-6-yl)oxy]phenyl]hydrazinylidene]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(C#N)=NNc1cc(Cl)c(Oc2ccc3c(c2)CCN(c2cccnc2)C3=O)c(Cl)c1 |
| InChI | InChI=1S/C26H20Cl2N6O5/c1-2-38-26(37)31-24(35)22(13-29)33-32-16-11-20(27)23(21(28)12-16)39-18-5-6-19-15(10-18)7-9-34(25(19)36)17-4-3-8-30-14-17/h3-6,8,10-12,14,32H,2,7,9H2,1H3,(H,31,35,37) |
| InChIKey | VCHUOIXHWVAPID-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 146.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.39 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|