C24H17BNO3 — CID 170675719
CID 170675719 (PubChem CID 170675719) has the molecular formula C24H17BNO3 and a molecular weight of 378.22 g/mol.
| Compound Name | CID 170675719 |
|---|---|
| PubChem CID | 170675719 |
| Molecular Formula | C24H17BNO3 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | — |
| SMILES | O[B]Oc1ccc(N(c2ccccc2)c2ccc3c(c2)oc2ccccc23)cc1 |
| InChI | InChI=1S/C24H17BNO3/c27-25-29-20-13-10-18(11-14-20)26(17-6-2-1-3-7-17)19-12-15-22-21-8-4-5-9-23(21)28-24(22)16-19/h1-16,27H |
| InChIKey | DZVHKKOVEQUPBX-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|