C14H13N3O3 — CID 17067632
2-(4-methoxyphenyl)-6-methyl-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione (PubChem CID 17067632) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-6-methyl-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione.
| Compound Name | 2-(4-methoxyphenyl)-6-methyl-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione |
|---|---|
| PubChem CID | 17067632 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-(4-methoxyphenyl)-6-methyl-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione |
| SMILES | COc1ccc(-n2[nH]c3[nH]c(C)cc(=O)c3c2=O)cc1 |
| InChI | InChI=1S/C14H13N3O3/c1-8-7-11(18)12-13(15-8)16-17(14(12)19)9-3-5-10(20-2)6-4-9/h3-7H,1-2H3,(H2,15,16,18) |
| InChIKey | DICFZVBDXCTFQL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|