C20H17N3O4 — CID 17067657
6-(2-methoxyphenyl)-2-(4-methoxyphenyl)-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione (PubChem CID 17067657) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is 6-(2-methoxyphenyl)-2-(4-methoxyphenyl)-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione.
| Compound Name | 6-(2-methoxyphenyl)-2-(4-methoxyphenyl)-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione |
|---|---|
| PubChem CID | 17067657 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 6-(2-methoxyphenyl)-2-(4-methoxyphenyl)-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione |
| SMILES | COc1ccc(-n2[nH]c3[nH]c(-c4ccccc4OC)cc(=O)c3c2=O)cc1 |
| InChI | InChI=1S/C20H17N3O4/c1-26-13-9-7-12(8-10-13)23-20(25)18-16(24)11-15(21-19(18)22-23)14-5-3-4-6-17(14)27-2/h3-11H,1-2H3,(H2,21,22,24) |
| InChIKey | JSTLUDFLHDYVRV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|