C22H16BrClF3N7O2S — CID 170676995
1-bromoethenyl 2-[4-[(6-chloro-2-methylindazol-5-yl)amino]-2,6-dioxo-3-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazin-1-yl]ethanimidothioate (PubChem CID 170676995) has the molecular formula C22H16BrClF3N7O2S and a molecular weight of 614.84 g/mol. Its IUPAC name is 1-bromoethenyl 2-[4-[(6-chloro-2-methylindazol-5-yl)amino]-2,6-dioxo-3-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazin-1-yl]ethanimidothioate.
| Compound Name | 1-bromoethenyl 2-[4-[(6-chloro-2-methylindazol-5-yl)amino]-2,6-dioxo-3-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazin-1-yl]ethanimidothioate |
|---|---|
| PubChem CID | 170676995 |
| Molecular Formula | C22H16BrClF3N7O2S |
| Molecular Weight | 614.84 g/mol |
| Exact Mass | 612.99 |
| IUPAC Name | 1-bromoethenyl 2-[4-[(6-chloro-2-methylindazol-5-yl)amino]-2,6-dioxo-3-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazin-1-yl]ethanimidothioate |
| SMILES | [H]/N=C(/Cn1c(=O)nc(Nc2cc3cn(C)nc3cc2Cl)n(Cc2cc(F)c(F)cc2F)c1=O)SC(=C)Br |
| InChI | InChI=1S/C22H16BrClF3N7O2S/c1-10(23)37-19(28)9-34-21(35)30-20(29-18-4-12-7-32(2)31-17(12)5-13(18)24)33(22(34)36)8-11-3-15(26)16(27)6-14(11)25/h3-7,28H,1,8-9H2,2H3,(H,29,30,35)/b28-19- |
| InChIKey | PGVFKTLFFSBFFG-USHMODERSA-N |
| XLogP | 4.73 |
| TPSA | 110.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.84 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|