C22H19FN4O2 — CID 170677930
N-[5-[2-[4-(fluoromethoxy)phenyl]ethynyl]-8-(methylamino)-2,7-naphthyridin-3-yl]cyclopropanecarboxamide (PubChem CID 170677930) has the molecular formula C22H19FN4O2 and a molecular weight of 390.42 g/mol. Its IUPAC name is N-[5-[2-[4-(fluoromethoxy)phenyl]ethynyl]-8-(methylamino)-2,7-naphthyridin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[5-[2-[4-(fluoromethoxy)phenyl]ethynyl]-8-(methylamino)-2,7-naphthyridin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 170677930 |
| Molecular Formula | C22H19FN4O2 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N-[5-[2-[4-(fluoromethoxy)phenyl]ethynyl]-8-(methylamino)-2,7-naphthyridin-3-yl]cyclopropanecarboxamide |
| SMILES | CNc1ncc(C#Cc2ccc(OCF)cc2)c2cc(NC(=O)C3CC3)ncc12 |
| InChI | InChI=1S/C22H19FN4O2/c1-24-21-19-12-25-20(27-22(28)15-6-7-15)10-18(19)16(11-26-21)5-2-14-3-8-17(9-4-14)29-13-23/h3-4,8-12,15H,6-7,13H2,1H3,(H,24,26)(H,25,27,28) |
| InChIKey | GGHVXXCSGLWEIX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|