About 1-[4-cyano-1-(4,6-dimethylpyrimidin-2-yl)pyrazol-5-yl]-3-phenylurea
1-[4-cyano-1-(4,6-dimethylpyrimidin-2-yl)pyrazol-5-yl]-3-phenylurea (PubChem CID 17067816) has the molecular formula C17H15N7O
and a molecular weight of 333.36 g/mol. Its IUPAC name is 1-[4-cyano-1-(4,6-dimethylpyrimidin-2-yl)pyrazol-5-yl]-3-phenylurea.
Molecular Properties
| Compound Name | 1-[4-cyano-1-(4,6-dimethylpyrimidin-2-yl)pyrazol-5-yl]-3-phenylurea |
| PubChem CID | 17067816 |
| Molecular Formula | C17H15N7O |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 1-[4-cyano-1-(4,6-dimethylpyrimidin-2-yl)pyrazol-5-yl]-3-phenylurea |
| SMILES | Cc1cc(C)nc(-n2ncc(C#N)c2NC(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C17H15N7O/c1-11-8-12(2)21-16(20-11)24-15(13(9-18)10-19-24)23-17(25)22-14-6-4-3-5-7-14/h3-8,10H,1-2H3,(H2,22,23,25) |
| InChIKey | HBSFDZGDDSPRFL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-cyano-1-(4,6-dimethylpyrimidin-2-yl)pyrazol-5-yl]-3-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-cyano-1-(4,6-dimethylpyrimidin-2-yl)pyrazol-5-yl]-3-phenylurea?
The IUPAC name of 1-[4-cyano-1-(4,6-dimethylpyrimidin-2-yl)pyrazol-5-yl]-3-phenylurea (CID 17067816) is 1-[4-cyano-1-(4,6-dimethylpyrimidin-2-yl)pyrazol-5-yl]-3-phenylurea.
What is the SMILES notation for 1-[4-cyano-1-(4,6-dimethylpyrimidin-2-yl)pyrazol-5-yl]-3-phenylurea?
The canonical SMILES for 1-[4-cyano-1-(4,6-dimethylpyrimidin-2-yl)pyrazol-5-yl]-3-phenylurea is Cc1cc(C)nc(-n2ncc(C#N)c2NC(=O)Nc2ccccc2)n1.
What is the InChIKey of 1-[4-cyano-1-(4,6-dimethylpyrimidin-2-yl)pyrazol-5-yl]-3-phenylurea?
The InChIKey is HBSFDZGDDSPRFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N7O/c1-11-8-12(2)21-16(20-11)24-15(13(9-18)10-19-24)23-17(25)22-14-6-4-3-5-7-14/h3-8,10H,1-2H3,(H2,22,23,25).
What are the key properties of 1-[4-cyano-1-(4,6-dimethylpyrimidin-2-yl)pyrazol-5-yl]-3-phenylurea?
1-[4-cyano-1-(4,6-dimethylpyrimidin-2-yl)pyrazol-5-yl]-3-phenylurea has a molecular weight of 333.36 g/mol, XLogP of 2.79, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-cyano-1-(4,6-dimethylpyrimidin-2-yl)pyrazol-5-yl]-3-phenylurea is sourced from PubChem (CID 17067816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).