About 5-cyclohexylimino-2,6-dimethylheptan-3-one
5-cyclohexylimino-2,6-dimethylheptan-3-one (PubChem CID 170678555) has the molecular formula C15H27NO
and a molecular weight of 237.39 g/mol. Its IUPAC name is 5-cyclohexylimino-2,6-dimethylheptan-3-one.
Molecular Properties
| Compound Name | 5-cyclohexylimino-2,6-dimethylheptan-3-one |
| PubChem CID | 170678555 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 5-cyclohexylimino-2,6-dimethylheptan-3-one |
| SMILES | CC(C)C(=O)C/C(=N/C1CCCCC1)C(C)C |
| InChI | InChI=1S/C15H27NO/c1-11(2)14(10-15(17)12(3)4)16-13-8-6-5-7-9-13/h11-13H,5-10H2,1-4H3/b16-14- |
| InChIKey | SGWAQTMONSRSPO-PEZBUJJGSA-N |
| XLogP | 4.03 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclohexylimino-2,6-dimethylheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexylimino-2,6-dimethylheptan-3-one?
The IUPAC name of 5-cyclohexylimino-2,6-dimethylheptan-3-one (CID 170678555) is 5-cyclohexylimino-2,6-dimethylheptan-3-one.
What is the SMILES notation for 5-cyclohexylimino-2,6-dimethylheptan-3-one?
The canonical SMILES for 5-cyclohexylimino-2,6-dimethylheptan-3-one is CC(C)C(=O)C/C(=N/C1CCCCC1)C(C)C.
What is the InChIKey of 5-cyclohexylimino-2,6-dimethylheptan-3-one?
The InChIKey is SGWAQTMONSRSPO-PEZBUJJGSA-N. The full InChI is InChI=1S/C15H27NO/c1-11(2)14(10-15(17)12(3)4)16-13-8-6-5-7-9-13/h11-13H,5-10H2,1-4H3/b16-14-.
What are the key properties of 5-cyclohexylimino-2,6-dimethylheptan-3-one?
5-cyclohexylimino-2,6-dimethylheptan-3-one has a molecular weight of 237.39 g/mol, XLogP of 4.03, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexylimino-2,6-dimethylheptan-3-one is sourced from PubChem (CID 170678555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).