About 6-cyclohexylimino-3,7-diethylnonan-4-one
6-cyclohexylimino-3,7-diethylnonan-4-one (PubChem CID 170678649) has the molecular formula C19H35NO
and a molecular weight of 293.50 g/mol. Its IUPAC name is 6-cyclohexylimino-3,7-diethylnonan-4-one.
Molecular Properties
| Compound Name | 6-cyclohexylimino-3,7-diethylnonan-4-one |
| PubChem CID | 170678649 |
| Molecular Formula | C19H35NO |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | 6-cyclohexylimino-3,7-diethylnonan-4-one |
| SMILES | CCC(CC)C(=O)C/C(=N\C1CCCCC1)C(CC)CC |
| InChI | InChI=1S/C19H35NO/c1-5-15(6-2)18(14-19(21)16(7-3)8-4)20-17-12-10-9-11-13-17/h15-17H,5-14H2,1-4H3/b20-18+ |
| InChIKey | RYYHOSVXHYVNQR-CZIZESTLSA-N |
| XLogP | 5.59 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-cyclohexylimino-3,7-diethylnonan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclohexylimino-3,7-diethylnonan-4-one?
The IUPAC name of 6-cyclohexylimino-3,7-diethylnonan-4-one (CID 170678649) is 6-cyclohexylimino-3,7-diethylnonan-4-one.
What is the SMILES notation for 6-cyclohexylimino-3,7-diethylnonan-4-one?
The canonical SMILES for 6-cyclohexylimino-3,7-diethylnonan-4-one is CCC(CC)C(=O)C/C(=N\C1CCCCC1)C(CC)CC.
What is the InChIKey of 6-cyclohexylimino-3,7-diethylnonan-4-one?
The InChIKey is RYYHOSVXHYVNQR-CZIZESTLSA-N. The full InChI is InChI=1S/C19H35NO/c1-5-15(6-2)18(14-19(21)16(7-3)8-4)20-17-12-10-9-11-13-17/h15-17H,5-14H2,1-4H3/b20-18+.
What are the key properties of 6-cyclohexylimino-3,7-diethylnonan-4-one?
6-cyclohexylimino-3,7-diethylnonan-4-one has a molecular weight of 293.50 g/mol, XLogP of 5.59, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclohexylimino-3,7-diethylnonan-4-one is sourced from PubChem (CID 170678649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).