C40H52IrN2OS-2 — CID 170678964
[(Z)-3,7-diethyl-6-oxonon-4-en-4-yl]-methylazanide;iridium;3,3,6,6,9-pentamethyl-15-phenyl-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene (PubChem CID 170678964) has the molecular formula C40H52IrN2OS-2 and a molecular weight of 801.15 g/mol. Its IUPAC name is [(Z)-3,7-diethyl-6-oxonon-4-en-4-yl]-methylazanide;iridium;3,3,6,6,9-pentamethyl-15-phenyl-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene.
| Compound Name | [(Z)-3,7-diethyl-6-oxonon-4-en-4-yl]-methylazanide;iridium;3,3,6,6,9-pentamethyl-15-phenyl-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene |
|---|---|
| PubChem CID | 170678964 |
| Molecular Formula | C40H52IrN2OS-2 |
| Molecular Weight | 801.15 g/mol |
| Exact Mass | 801.34 |
| IUPAC Name | [(Z)-3,7-diethyl-6-oxonon-4-en-4-yl]-methylazanide;iridium;3,3,6,6,9-pentamethyl-15-phenyl-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene |
| SMILES | CCC(CC)C(=O)/C=C(\[N-]C)C(CC)CC.Cc1cc2c(c3sc4c(-c5[c-]cccc5)nccc4c13)C(C)(C)CCC2(C)C.[Ir] |
| InChI | InChI=1S/C26H26NS.C14H27NO.Ir/c1-16-15-19-21(26(4,5)13-12-25(19,2)3)24-20(16)18-11-14-27-22(23(18)28-24)17-9-7-6-8-10-17;1-6-11(7-2)13(15-5)10-14(16)12(8-3)9-4;/h6-9,11,14-15H,12-13H2,1-5H3;10-12H,6-9H2,1-5H3,(H,15,16);/q-1;;/p-1 |
| InChIKey | LOKNUFIQICITJV-UHFFFAOYSA-M |
| XLogP | 11.89 |
| TPSA | 44.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.15 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|