C9H15FO — CID 170679550
[(2S,3aR)-2-fluoro-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]methanol (PubChem CID 170679550) has the molecular formula C9H15FO and a molecular weight of 158.22 g/mol. Its IUPAC name is [(2S,3aR)-2-fluoro-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]methanol.
| Compound Name | [(2S,3aR)-2-fluoro-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]methanol |
|---|---|
| PubChem CID | 170679550 |
| Molecular Formula | C9H15FO |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | [(2S,3aR)-2-fluoro-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]methanol |
| SMILES | OC[C@@]12CCCC1C[C@H](F)C2 |
| InChI | InChI=1S/C9H15FO/c10-8-4-7-2-1-3-9(7,5-8)6-11/h7-8,11H,1-6H2/t7?,8-,9-/m0/s1 |
| InChIKey | RJUGMTRHIIGBEK-NPPUSCPJSA-N |
| XLogP | 1.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |