C19H17F3N6O — CID 170680035
4,4-dimethyl-2-[5-[[(1R)-1-(2,3,5-trifluorophenyl)ethyl]amino]pyrazolo[1,5-a]pyrimidin-3-yl]-1H-imidazol-5-one (PubChem CID 170680035) has the molecular formula C19H17F3N6O and a molecular weight of 402.38 g/mol. Its IUPAC name is 4,4-dimethyl-2-[5-[[(1R)-1-(2,3,5-trifluorophenyl)ethyl]amino]pyrazolo[1,5-a]pyrimidin-3-yl]-1H-imidazol-5-one.
| Compound Name | 4,4-dimethyl-2-[5-[[(1R)-1-(2,3,5-trifluorophenyl)ethyl]amino]pyrazolo[1,5-a]pyrimidin-3-yl]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 170680035 |
| Molecular Formula | C19H17F3N6O |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 4,4-dimethyl-2-[5-[[(1R)-1-(2,3,5-trifluorophenyl)ethyl]amino]pyrazolo[1,5-a]pyrimidin-3-yl]-1H-imidazol-5-one |
| SMILES | C[C@@H](Nc1ccn2ncc(C3=NC(C)(C)C(=O)N3)c2n1)c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C19H17F3N6O/c1-9(11-6-10(20)7-13(21)15(11)22)24-14-4-5-28-17(25-14)12(8-23-28)16-26-18(29)19(2,3)27-16/h4-9H,1-3H3,(H,24,25)(H,26,27,29)/t9-/m1/s1 |
| InChIKey | VUXOIOWPYAOXLO-SECBINFHSA-N |
| XLogP | 2.97 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|