C19H23N3O2 — CID 170680631
2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(3-methyl-1,2,4-triazol-1-yl)benzene-1,3-diol (PubChem CID 170680631) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(3-methyl-1,2,4-triazol-1-yl)benzene-1,3-diol.
| Compound Name | 2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(3-methyl-1,2,4-triazol-1-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 170680631 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(3-methyl-1,2,4-triazol-1-yl)benzene-1,3-diol |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(-n2cnc(C)n2)cc1O |
| InChI | InChI=1S/C19H23N3O2/c1-11(2)15-6-5-12(3)7-16(15)19-17(23)8-14(9-18(19)24)22-10-20-13(4)21-22/h7-10,15-16,23-24H,1,5-6H2,2-4H3/t15-,16+/m0/s1 |
| InChIKey | SWLUHQIZMDPTIF-JKSUJKDBSA-N |
| XLogP | 4.00 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|