C21H23NO3 — CID 170680633
2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pyridin-3-yloxybenzene-1,3-diol (PubChem CID 170680633) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pyridin-3-yloxybenzene-1,3-diol.
| Compound Name | 2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pyridin-3-yloxybenzene-1,3-diol |
|---|---|
| PubChem CID | 170680633 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pyridin-3-yloxybenzene-1,3-diol |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(Oc2cccnc2)cc1O |
| InChI | InChI=1S/C21H23NO3/c1-13(2)17-7-6-14(3)9-18(17)21-19(23)10-16(11-20(21)24)25-15-5-4-8-22-12-15/h4-5,8-12,17-18,23-24H,1,6-7H2,2-3H3/t17-,18+/m0/s1 |
| InChIKey | AKKAADBTFMSRPL-ZWKOTPCHSA-N |
| XLogP | 5.30 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|