About CID 170680649
CID 170680649 (PubChem CID 170680649) has the molecular formula ClI4-
and a molecular weight of 543.07 g/mol.
Molecular Properties
| Compound Name | CID 170680649 |
| PubChem CID | 170680649 |
| Molecular Formula | ClI4- |
| Molecular Weight | 543.07 g/mol |
| Exact Mass | 542.59 |
| IUPAC Name | — |
| SMILES | ClI1[I-]I1I |
| InChI | InChI=1S/ClI4/c1-4-3-5(4)2/q-1 |
| InChIKey | CYBIZDQEMUGTKX-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 543.07 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 170680649 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170680649?
The IUPAC name of CID 170680649 (CID 170680649) is not available.
What is the SMILES notation for CID 170680649?
The canonical SMILES for CID 170680649 is ClI1[I-]I1I.
What is the InChIKey of CID 170680649?
The InChIKey is CYBIZDQEMUGTKX-UHFFFAOYSA-N. The full InChI is InChI=1S/ClI4/c1-4-3-5(4)2/q-1.
What are the key properties of CID 170680649?
CID 170680649 has a molecular weight of 543.07 g/mol, XLogP of 0.35, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170680649 is sourced from PubChem (CID 170680649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).