C48H33N3O — CID 170681215
2-[4-(9,9-dimethylfluoren-3-yl)phenyl]-4-phenyl-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazine (PubChem CID 170681215) has the molecular formula C48H33N3O and a molecular weight of 667.81 g/mol. Its IUPAC name is 2-[4-(9,9-dimethylfluoren-3-yl)phenyl]-4-phenyl-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazine.
| Compound Name | 2-[4-(9,9-dimethylfluoren-3-yl)phenyl]-4-phenyl-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 170681215 |
| Molecular Formula | C48H33N3O |
| Molecular Weight | 667.81 g/mol |
| Exact Mass | 667.26 |
| IUPAC Name | 2-[4-(9,9-dimethylfluoren-3-yl)phenyl]-4-phenyl-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2cc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccc6c(c5)oc5cccc(-c7ccccc7)c56)n4)cc3)ccc21 |
| InChI | InChI=1S/C48H33N3O/c1-48(2)40-18-10-9-16-37(40)39-28-34(25-27-41(39)48)30-20-22-33(23-21-30)46-49-45(32-14-7-4-8-15-32)50-47(51-46)35-24-26-38-43(29-35)52-42-19-11-17-36(44(38)42)31-12-5-3-6-13-31/h3-29H,1-2H3 |
| InChIKey | BZOATJDCGWTHAO-UHFFFAOYSA-N |
| XLogP | 12.41 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.81 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |