About benzo[c][1,6]benzodioxocine
benzo[c][1,6]benzodioxocine (PubChem CID 170684169) has the molecular formula C14H10O2
and a molecular weight of 210.23 g/mol. Its IUPAC name is benzo[c][1,6]benzodioxocine.
Molecular Properties
| Compound Name | benzo[c][1,6]benzodioxocine |
| PubChem CID | 170684169 |
| Molecular Formula | C14H10O2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | benzo[c][1,6]benzodioxocine |
| SMILES | c1ccc2coc3ccccc3occ2c1 |
| InChI | InChI=1S/C14H10O2/c1-2-6-12-10-16-14-8-4-3-7-13(14)15-9-11(12)5-1/h1-10H/b11-9-,12-10- |
| InChIKey | ISFMFVNYUIWWBI-HWAYABPNSA-N |
| XLogP | 4.30 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzo[c][1,6]benzodioxocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[c][1,6]benzodioxocine?
The IUPAC name of benzo[c][1,6]benzodioxocine (CID 170684169) is benzo[c][1,6]benzodioxocine.
What is the SMILES notation for benzo[c][1,6]benzodioxocine?
The canonical SMILES for benzo[c][1,6]benzodioxocine is c1ccc2coc3ccccc3occ2c1.
What is the InChIKey of benzo[c][1,6]benzodioxocine?
The InChIKey is ISFMFVNYUIWWBI-HWAYABPNSA-N. The full InChI is InChI=1S/C14H10O2/c1-2-6-12-10-16-14-8-4-3-7-13(14)15-9-11(12)5-1/h1-10H/b11-9-,12-10-.
What are the key properties of benzo[c][1,6]benzodioxocine?
benzo[c][1,6]benzodioxocine has a molecular weight of 210.23 g/mol, XLogP of 4.30, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[c][1,6]benzodioxocine is sourced from PubChem (CID 170684169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).