C27H23N4+ — CID 170685036
19-(2-isocyano-2-methylpropyl)-11,14-dimethyl-1,3-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaene (PubChem CID 170685036) has the molecular formula C27H23N4+ and a molecular weight of 403.51 g/mol. Its IUPAC name is 19-(2-isocyano-2-methylpropyl)-11,14-dimethyl-1,3-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaene.
| Compound Name | 19-(2-isocyano-2-methylpropyl)-11,14-dimethyl-1,3-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaene |
|---|---|
| PubChem CID | 170685036 |
| Molecular Formula | C27H23N4+ |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 19-(2-isocyano-2-methylpropyl)-11,14-dimethyl-1,3-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaene |
| SMILES | [C-]#[N+]C(C)(C)Cc1cc2cc[n+](C)c3c4c(C)ccc5c6cccnc6n(c(c1)c23)c54 |
| InChI | InChI=1S/C27H23N4/c1-16-8-9-19-20-7-6-11-29-26(20)31-21-14-17(15-27(2,3)28-4)13-18-10-12-30(5)25(23(18)21)22(16)24(19)31/h6-14H,15H2,1-3,5H3/q+1 |
| InChIKey | DVMIRPLXZAJFTD-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 25.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|