C18H20FO3- — CID 170685938
4-fluoro-3-[(8-methyl-8-tricyclo[5.2.1.02,6]decanyl)oxy]benzoate (PubChem CID 170685938) has the molecular formula C18H20FO3- and a molecular weight of 303.35 g/mol. Its IUPAC name is 4-fluoro-3-[(8-methyl-8-tricyclo[5.2.1.02,6]decanyl)oxy]benzoate.
| Compound Name | 4-fluoro-3-[(8-methyl-8-tricyclo[5.2.1.02,6]decanyl)oxy]benzoate |
|---|---|
| PubChem CID | 170685938 |
| Molecular Formula | C18H20FO3- |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 4-fluoro-3-[(8-methyl-8-tricyclo[5.2.1.02,6]decanyl)oxy]benzoate |
| SMILES | CC1(Oc2cc(C(=O)[O-])ccc2F)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C18H21FO3/c1-18(9-11-7-14(18)13-4-2-3-12(11)13)22-16-8-10(17(20)21)5-6-15(16)19/h5-6,8,11-14H,2-4,7,9H2,1H3,(H,20,21)/p-1 |
| InChIKey | CGTDAVKPTYDZQT-UHFFFAOYSA-M |
| XLogP | 2.78 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |