C19H20FO3- — CID 170685942
3-[(8-ethenyl-8-tricyclo[5.2.1.02,6]decanyl)oxy]-4-fluorobenzoate (PubChem CID 170685942) has the molecular formula C19H20FO3- and a molecular weight of 315.36 g/mol. Its IUPAC name is 3-[(8-ethenyl-8-tricyclo[5.2.1.02,6]decanyl)oxy]-4-fluorobenzoate.
| Compound Name | 3-[(8-ethenyl-8-tricyclo[5.2.1.02,6]decanyl)oxy]-4-fluorobenzoate |
|---|---|
| PubChem CID | 170685942 |
| Molecular Formula | C19H20FO3- |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 3-[(8-ethenyl-8-tricyclo[5.2.1.02,6]decanyl)oxy]-4-fluorobenzoate |
| SMILES | C=CC1(Oc2cc(C(=O)[O-])ccc2F)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C19H21FO3/c1-2-19(10-12-8-15(19)14-5-3-4-13(12)14)23-17-9-11(18(21)22)6-7-16(17)20/h2,6-7,9,12-15H,1,3-5,8,10H2,(H,21,22)/p-1 |
| InChIKey | UORAMWUDKTWASW-UHFFFAOYSA-M |
| XLogP | 2.95 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|