C21H22F3O3- — CID 170685982
3-[(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]-4-(trifluoromethyl)benzoate (PubChem CID 170685982) has the molecular formula C21H22F3O3- and a molecular weight of 379.40 g/mol. Its IUPAC name is 3-[(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]-4-(trifluoromethyl)benzoate.
| Compound Name | 3-[(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 170685982 |
| Molecular Formula | C21H22F3O3- |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 3-[(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]-4-(trifluoromethyl)benzoate |
| SMILES | CC1(Oc2cc(C(=O)[O-])ccc2C(F)(F)F)CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C21H23F3O3/c1-20(9-13-7-15(20)18-11-3-2-10(6-11)17(13)18)27-16-8-12(19(25)26)4-5-14(16)21(22,23)24/h4-5,8,10-11,13,15,17-18H,2-3,6-7,9H2,1H3,(H,25,26)/p-1 |
| InChIKey | SJXCVDUCALSISY-UHFFFAOYSA-M |
| XLogP | 3.91 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|