C20H22FO3- — CID 170685984
4-fluoro-3-[(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]benzoate (PubChem CID 170685984) has the molecular formula C20H22FO3- and a molecular weight of 329.39 g/mol. Its IUPAC name is 4-fluoro-3-[(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]benzoate.
| Compound Name | 4-fluoro-3-[(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]benzoate |
|---|---|
| PubChem CID | 170685984 |
| Molecular Formula | C20H22FO3- |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 4-fluoro-3-[(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]benzoate |
| SMILES | CC1(Oc2cc(C(=O)[O-])ccc2F)CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C20H23FO3/c1-20(24-16-8-12(19(22)23)4-5-15(16)21)9-13-7-14(20)18-11-3-2-10(6-11)17(13)18/h4-5,8,10-11,13-14,17-18H,2-3,6-7,9H2,1H3,(H,22,23)/p-1 |
| InChIKey | KGWNCTXGXALELY-UHFFFAOYSA-M |
| XLogP | 3.03 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|