About 3-fluoro-4,5-bis[(1-propan-2-ylcyclopentyl)oxy]benzoate
3-fluoro-4,5-bis[(1-propan-2-ylcyclopentyl)oxy]benzoate (PubChem CID 170685994) has the molecular formula C23H32FO4-
and a molecular weight of 391.50 g/mol. Its IUPAC name is 3-fluoro-4,5-bis[(1-propan-2-ylcyclopentyl)oxy]benzoate.
Molecular Properties
| Compound Name | 3-fluoro-4,5-bis[(1-propan-2-ylcyclopentyl)oxy]benzoate |
| PubChem CID | 170685994 |
| Molecular Formula | C23H32FO4- |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 3-fluoro-4,5-bis[(1-propan-2-ylcyclopentyl)oxy]benzoate |
| SMILES | CC(C)C1(Oc2cc(C(=O)[O-])cc(F)c2OC2(C(C)C)CCCC2)CCCC1 |
| InChI | InChI=1S/C23H33FO4/c1-15(2)22(9-5-6-10-22)27-19-14-17(21(25)26)13-18(24)20(19)28-23(16(3)4)11-7-8-12-23/h13-16H,5-12H2,1-4H3,(H,25,26)/p-1 |
| InChIKey | VZWBKOZZZJLVER-UHFFFAOYSA-M |
| XLogP | 4.88 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-fluoro-4,5-bis[(1-propan-2-ylcyclopentyl)oxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4,5-bis[(1-propan-2-ylcyclopentyl)oxy]benzoate?
The IUPAC name of 3-fluoro-4,5-bis[(1-propan-2-ylcyclopentyl)oxy]benzoate (CID 170685994) is 3-fluoro-4,5-bis[(1-propan-2-ylcyclopentyl)oxy]benzoate.
What is the SMILES notation for 3-fluoro-4,5-bis[(1-propan-2-ylcyclopentyl)oxy]benzoate?
The canonical SMILES for 3-fluoro-4,5-bis[(1-propan-2-ylcyclopentyl)oxy]benzoate is CC(C)C1(Oc2cc(C(=O)[O-])cc(F)c2OC2(C(C)C)CCCC2)CCCC1.
What is the InChIKey of 3-fluoro-4,5-bis[(1-propan-2-ylcyclopentyl)oxy]benzoate?
The InChIKey is VZWBKOZZZJLVER-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H33FO4/c1-15(2)22(9-5-6-10-22)27-19-14-17(21(25)26)13-18(24)20(19)28-23(16(3)4)11-7-8-12-23/h13-16H,5-12H2,1-4H3,(H,25,26)/p-1.
What are the key properties of 3-fluoro-4,5-bis[(1-propan-2-ylcyclopentyl)oxy]benzoate?
3-fluoro-4,5-bis[(1-propan-2-ylcyclopentyl)oxy]benzoate has a molecular weight of 391.50 g/mol, XLogP of 4.88, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4,5-bis[(1-propan-2-ylcyclopentyl)oxy]benzoate is sourced from PubChem (CID 170685994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).