C22H22F3O3- — CID 170686138
3-[(4-ethenyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]-4-(trifluoromethyl)benzoate (PubChem CID 170686138) has the molecular formula C22H22F3O3- and a molecular weight of 391.41 g/mol. Its IUPAC name is 3-[(4-ethenyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]-4-(trifluoromethyl)benzoate.
| Compound Name | 3-[(4-ethenyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 170686138 |
| Molecular Formula | C22H22F3O3- |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 3-[(4-ethenyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]-4-(trifluoromethyl)benzoate |
| SMILES | C=CC1(Oc2cc(C(=O)[O-])ccc2C(F)(F)F)CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C22H23F3O3/c1-2-21(10-14-8-16(21)19-12-4-3-11(7-12)18(14)19)28-17-9-13(20(26)27)5-6-15(17)22(23,24)25/h2,5-6,9,11-12,14,16,18-19H,1,3-4,7-8,10H2,(H,26,27)/p-1 |
| InChIKey | XYGRAQXTFXZREU-UHFFFAOYSA-M |
| XLogP | 4.07 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|