C22H26FO3- — CID 170686216
4-fluoro-3-[(4-propan-2-yl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]benzoate (PubChem CID 170686216) has the molecular formula C22H26FO3- and a molecular weight of 357.45 g/mol. Its IUPAC name is 4-fluoro-3-[(4-propan-2-yl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]benzoate.
| Compound Name | 4-fluoro-3-[(4-propan-2-yl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]benzoate |
|---|---|
| PubChem CID | 170686216 |
| Molecular Formula | C22H26FO3- |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 4-fluoro-3-[(4-propan-2-yl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]benzoate |
| SMILES | CC(C)C1(Oc2cc(C(=O)[O-])ccc2F)CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C22H27FO3/c1-11(2)22(26-18-9-14(21(24)25)5-6-17(18)23)10-15-8-16(22)20-13-4-3-12(7-13)19(15)20/h5-6,9,11-13,15-16,19-20H,3-4,7-8,10H2,1-2H3,(H,24,25)/p-1 |
| InChIKey | MFBDZFSQZFEYDR-UHFFFAOYSA-M |
| XLogP | 3.66 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|