C22H26F3O4- — CID 170686302
3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]-4-(trifluoromethyl)benzoate (PubChem CID 170686302) has the molecular formula C22H26F3O4- and a molecular weight of 411.44 g/mol. Its IUPAC name is 3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]-4-(trifluoromethyl)benzoate.
| Compound Name | 3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 170686302 |
| Molecular Formula | C22H26F3O4- |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]-4-(trifluoromethyl)benzoate |
| SMILES | CC(C)C(Oc1cc(C(=O)[O-])ccc1C(F)(F)F)OC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C22H27F3O4/c1-11(2)21(28-18-10-13-8-16(18)15-5-3-4-14(13)15)29-19-9-12(20(26)27)6-7-17(19)22(23,24)25/h6-7,9,11,13-16,18,21H,3-5,8,10H2,1-2H3,(H,26,27)/p-1 |
| InChIKey | JEXXVBMOCALXLD-UHFFFAOYSA-M |
| XLogP | 4.27 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|