About 5-fluoro-2-propan-2-yl-2,7-diazaspiro[3.4]octane
5-fluoro-2-propan-2-yl-2,7-diazaspiro[3.4]octane (PubChem CID 170686929) has the molecular formula C9H17FN2
and a molecular weight of 172.25 g/mol. Its IUPAC name is 5-fluoro-2-propan-2-yl-2,7-diazaspiro[3.4]octane.
Molecular Properties
| Compound Name | 5-fluoro-2-propan-2-yl-2,7-diazaspiro[3.4]octane |
| PubChem CID | 170686929 |
| Molecular Formula | C9H17FN2 |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.14 |
| IUPAC Name | 5-fluoro-2-propan-2-yl-2,7-diazaspiro[3.4]octane |
| SMILES | CC(C)N1CC2(CNCC2F)C1 |
| InChI | InChI=1S/C9H17FN2/c1-7(2)12-5-9(6-12)4-11-3-8(9)10/h7-8,11H,3-6H2,1-2H3 |
| InChIKey | OXGXZOKXBBCHJQ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-2-propan-2-yl-2,7-diazaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-propan-2-yl-2,7-diazaspiro[3.4]octane?
The IUPAC name of 5-fluoro-2-propan-2-yl-2,7-diazaspiro[3.4]octane (CID 170686929) is 5-fluoro-2-propan-2-yl-2,7-diazaspiro[3.4]octane.
What is the SMILES notation for 5-fluoro-2-propan-2-yl-2,7-diazaspiro[3.4]octane?
The canonical SMILES for 5-fluoro-2-propan-2-yl-2,7-diazaspiro[3.4]octane is CC(C)N1CC2(CNCC2F)C1.
What is the InChIKey of 5-fluoro-2-propan-2-yl-2,7-diazaspiro[3.4]octane?
The InChIKey is OXGXZOKXBBCHJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17FN2/c1-7(2)12-5-9(6-12)4-11-3-8(9)10/h7-8,11H,3-6H2,1-2H3.
What are the key properties of 5-fluoro-2-propan-2-yl-2,7-diazaspiro[3.4]octane?
5-fluoro-2-propan-2-yl-2,7-diazaspiro[3.4]octane has a molecular weight of 172.25 g/mol, XLogP of 0.64, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-propan-2-yl-2,7-diazaspiro[3.4]octane is sourced from PubChem (CID 170686929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).