C24H22FN5O4 — CID 170687589
N-[3-fluoro-4-[[(3R)-1-prop-2-enoylpiperidine-3-carbonyl]amino]phenyl]-6-(1,2-oxazol-4-yl)pyridine-2-carboxamide (PubChem CID 170687589) has the molecular formula C24H22FN5O4 and a molecular weight of 463.47 g/mol. Its IUPAC name is N-[3-fluoro-4-[[(3R)-1-prop-2-enoylpiperidine-3-carbonyl]amino]phenyl]-6-(1,2-oxazol-4-yl)pyridine-2-carboxamide.
| Compound Name | N-[3-fluoro-4-[[(3R)-1-prop-2-enoylpiperidine-3-carbonyl]amino]phenyl]-6-(1,2-oxazol-4-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 170687589 |
| Molecular Formula | C24H22FN5O4 |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | N-[3-fluoro-4-[[(3R)-1-prop-2-enoylpiperidine-3-carbonyl]amino]phenyl]-6-(1,2-oxazol-4-yl)pyridine-2-carboxamide |
| SMILES | C=CC(=O)N1CCC[C@@H](C(=O)Nc2ccc(NC(=O)c3cccc(-c4cnoc4)n3)cc2F)C1 |
| InChI | InChI=1S/C24H22FN5O4/c1-2-22(31)30-10-4-5-15(13-30)23(32)29-20-9-8-17(11-18(20)25)27-24(33)21-7-3-6-19(28-21)16-12-26-34-14-16/h2-3,6-9,11-12,14-15H,1,4-5,10,13H2,(H,27,33)(H,29,32)/t15-/m1/s1 |
| InChIKey | XOEYQRKCJFQPPX-OAHLLOKOSA-N |
| XLogP | 3.49 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|