C21H26ClN3O3Si — CID 170688403
2-[[6-chloro-3-(5-methoxy-1,3-benzoxazol-6-yl)-2,3-dihydropyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 170688403) has the molecular formula C21H26ClN3O3Si and a molecular weight of 432.00 g/mol. Its IUPAC name is 2-[[6-chloro-3-(5-methoxy-1,3-benzoxazol-6-yl)-2,3-dihydropyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[6-chloro-3-(5-methoxy-1,3-benzoxazol-6-yl)-2,3-dihydropyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 170688403 |
| Molecular Formula | C21H26ClN3O3Si |
| Molecular Weight | 432.00 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 2-[[6-chloro-3-(5-methoxy-1,3-benzoxazol-6-yl)-2,3-dihydropyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COc1cc2ncoc2cc1C1CN(COCC[Si](C)(C)C)c2nc(Cl)ccc21 |
| InChI | InChI=1S/C21H26ClN3O3Si/c1-26-18-10-17-19(28-12-23-17)9-15(18)16-11-25(13-27-7-8-29(2,3)4)21-14(16)5-6-20(22)24-21/h5-6,9-10,12,16H,7-8,11,13H2,1-4H3 |
| InChIKey | WJCSGFDHEAHLSV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 60.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.00 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|