C36H21NOS — CID 170688581
1,2,3,4,5,6,7,8-octadeuterio-9-[2,3,4,6,8,9-hexadeuterio-7-(1,2,3,6,7,8,9-heptadeuteriodibenzofuran-4-yl)dibenzothiophen-1-yl]carbazole (PubChem CID 170688581) has the molecular formula C36H21NOS and a molecular weight of 536.77 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octadeuterio-9-[2,3,4,6,8,9-hexadeuterio-7-(1,2,3,6,7,8,9-heptadeuteriodibenzofuran-4-yl)dibenzothiophen-1-yl]carbazole.
| Compound Name | 1,2,3,4,5,6,7,8-octadeuterio-9-[2,3,4,6,8,9-hexadeuterio-7-(1,2,3,6,7,8,9-heptadeuteriodibenzofuran-4-yl)dibenzothiophen-1-yl]carbazole |
|---|---|
| PubChem CID | 170688581 |
| Molecular Formula | C36H21NOS |
| Molecular Weight | 536.77 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octadeuterio-9-[2,3,4,6,8,9-hexadeuterio-7-(1,2,3,6,7,8,9-heptadeuteriodibenzofuran-4-yl)dibenzothiophen-1-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c(-c4c([2H])c([2H])c5c(sc6c([2H])c([2H])c([2H])c(-n7c8c([2H])c([2H])c([2H])c([2H])c8c8c([2H])c([2H])c([2H])c([2H])c87)c65)c4[2H])c([2H])c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C36H21NOS/c1-4-14-29-24(9-1)25-10-2-5-15-30(25)37(29)31-16-8-18-33-35(31)28-20-19-22(21-34(28)39-33)23-12-7-13-27-26-11-3-6-17-32(26)38-36(23)27/h1-21H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,15D,16D,17D,18D,19D,20D,21D |
| InChIKey | XLHHJRSCPZPRJG-DWNMPCLQSA-N |
| XLogP | 10.72 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.77 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |