C25H37F5OSSi — CID 170689254
dimethyl-(2,3,4,5,6-pentafluorophenyl)-[11-(3-propan-2-yloxypropylsulfanyl)undec-1-ynyl]silane (PubChem CID 170689254) has the molecular formula C25H37F5OSSi and a molecular weight of 508.71 g/mol. Its IUPAC name is dimethyl-(2,3,4,5,6-pentafluorophenyl)-[11-(3-propan-2-yloxypropylsulfanyl)undec-1-ynyl]silane.
| Compound Name | dimethyl-(2,3,4,5,6-pentafluorophenyl)-[11-(3-propan-2-yloxypropylsulfanyl)undec-1-ynyl]silane |
|---|---|
| PubChem CID | 170689254 |
| Molecular Formula | C25H37F5OSSi |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | dimethyl-(2,3,4,5,6-pentafluorophenyl)-[11-(3-propan-2-yloxypropylsulfanyl)undec-1-ynyl]silane |
| SMILES | CC(C)OCCCSCCCCCCCCCC#C[Si](C)(C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C25H37F5OSSi/c1-19(2)31-15-14-17-32-16-12-10-8-6-5-7-9-11-13-18-33(3,4)25-23(29)21(27)20(26)22(28)24(25)30/h19H,5-12,14-17H2,1-4H3 |
| InChIKey | HCZPFTJPBBJSEP-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|