C32H29BN4 — CID 170690057
6,11-ditert-butyl-2,15,16,17-tetraza-14-boraoctacyclo[12.12.1.12,9.115,18.03,8.023,27.013,29.022,28]nonacosa-1(26),3(8),4,6,9(29),10,12,16,18,20,22(28),23(27),24-tridecaene (PubChem CID 170690057) has the molecular formula C32H29BN4 and a molecular weight of 480.42 g/mol. Its IUPAC name is 6,11-ditert-butyl-2,15,16,17-tetraza-14-boraoctacyclo[12.12.1.12,9.115,18.03,8.023,27.013,29.022,28]nonacosa-1(26),3(8),4,6,9(29),10,12,16,18,20,22(28),23(27),24-tridecaene.
| Compound Name | 6,11-ditert-butyl-2,15,16,17-tetraza-14-boraoctacyclo[12.12.1.12,9.115,18.03,8.023,27.013,29.022,28]nonacosa-1(26),3(8),4,6,9(29),10,12,16,18,20,22(28),23(27),24-tridecaene |
|---|---|
| PubChem CID | 170690057 |
| Molecular Formula | C32H29BN4 |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 6,11-ditert-butyl-2,15,16,17-tetraza-14-boraoctacyclo[12.12.1.12,9.115,18.03,8.023,27.013,29.022,28]nonacosa-1(26),3(8),4,6,9(29),10,12,16,18,20,22(28),23(27),24-tridecaene |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)cc3c1n2-c1cccc2c1B3n1nnc3cccc-2c31 |
| InChI | InChI=1S/C32H29BN4/c1-31(2,3)18-13-14-26-22(15-18)23-16-19(32(4,5)6)17-24-29(23)36(26)27-12-8-9-20-21-10-7-11-25-30(21)37(35-34-25)33(24)28(20)27/h7-17H,1-6H3 |
| InChIKey | FTDNVUDTADMIMA-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|