C27H29N5 — CID 170690844
1-[5-(5-methyl-1H-pyrazol-3-yl)pentyl]-3,6-diphenyl-2H-imidazo[4,5-b]pyridine (PubChem CID 170690844) has the molecular formula C27H29N5 and a molecular weight of 423.56 g/mol. Its IUPAC name is 1-[5-(5-methyl-1H-pyrazol-3-yl)pentyl]-3,6-diphenyl-2H-imidazo[4,5-b]pyridine.
| Compound Name | 1-[5-(5-methyl-1H-pyrazol-3-yl)pentyl]-3,6-diphenyl-2H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 170690844 |
| Molecular Formula | C27H29N5 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 1-[5-(5-methyl-1H-pyrazol-3-yl)pentyl]-3,6-diphenyl-2H-imidazo[4,5-b]pyridine |
| SMILES | Cc1cc(CCCCCN2CN(c3ccccc3)c3ncc(-c4ccccc4)cc32)n[nH]1 |
| InChI | InChI=1S/C27H29N5/c1-21-17-24(30-29-21)13-7-4-10-16-31-20-32(25-14-8-3-9-15-25)27-26(31)18-23(19-28-27)22-11-5-2-6-12-22/h2-3,5-6,8-9,11-12,14-15,17-19H,4,7,10,13,16,20H2,1H3,(H,29,30) |
| InChIKey | HUFZFKAYNKGLLQ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|