C20H27NO3 — CID 170691352
N-[(2-ethoxyphenyl)methyl]-N,7,7-trimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 170691352) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is N-[(2-ethoxyphenyl)methyl]-N,7,7-trimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | N-[(2-ethoxyphenyl)methyl]-N,7,7-trimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 170691352 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | N-[(2-ethoxyphenyl)methyl]-N,7,7-trimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CCOc1ccccc1CN(C)C(=O)C12CCC(CC1=O)C2(C)C |
| InChI | InChI=1S/C20H27NO3/c1-5-24-16-9-7-6-8-14(16)13-21(4)18(23)20-11-10-15(12-17(20)22)19(20,2)3/h6-9,15H,5,10-13H2,1-4H3 |
| InChIKey | UONZUHGDSMGBMD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|