C22H30F3NO3S — CID 170691392
N-benzyl-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-N-(5,5,5-trifluoropentyl)methanesulfonamide (PubChem CID 170691392) has the molecular formula C22H30F3NO3S and a molecular weight of 445.55 g/mol. Its IUPAC name is N-benzyl-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-N-(5,5,5-trifluoropentyl)methanesulfonamide.
| Compound Name | N-benzyl-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-N-(5,5,5-trifluoropentyl)methanesulfonamide |
|---|---|
| PubChem CID | 170691392 |
| Molecular Formula | C22H30F3NO3S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | N-benzyl-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-N-(5,5,5-trifluoropentyl)methanesulfonamide |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)N(CCCCC(F)(F)F)Cc1ccccc1)C(=O)C2 |
| InChI | InChI=1S/C22H30F3NO3S/c1-20(2)18-10-12-21(20,19(27)14-18)16-30(28,29)26(13-7-6-11-22(23,24)25)15-17-8-4-3-5-9-17/h3-5,8-9,18H,6-7,10-16H2,1-2H3 |
| InChIKey | KQXUVRMKRDULBZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|