C12H10O2 — CID 170691804
8-tricyclo[5.3.1.01,5]undeca-3,5,7,9-tetraenyl formate (PubChem CID 170691804) has the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. Its IUPAC name is 8-tricyclo[5.3.1.01,5]undeca-3,5,7,9-tetraenyl formate.
| Compound Name | 8-tricyclo[5.3.1.01,5]undeca-3,5,7,9-tetraenyl formate |
|---|---|
| PubChem CID | 170691804 |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 8-tricyclo[5.3.1.01,5]undeca-3,5,7,9-tetraenyl formate |
| SMILES | O=COC1=C2C=C3C=CCC3(C=C1)C2 |
| InChI | InChI=1S/C12H10O2/c13-8-14-11-3-5-12-4-1-2-10(12)6-9(11)7-12/h1-3,5-6,8H,4,7H2 |
| InChIKey | YFLBXXGSRGYIAJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|