C24H24F3N5O6 — CID 170692038
(2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-[[3-(2-methoxy-4-pyridinyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 170692038) has the molecular formula C24H24F3N5O6 and a molecular weight of 535.48 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-[[3-(2-methoxy-4-pyridinyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-[[3-(2-methoxy-4-pyridinyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 170692038 |
| Molecular Formula | C24H24F3N5O6 |
| Molecular Weight | 535.48 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | (2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-[[3-(2-methoxy-4-pyridinyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | COc1cc(C2=NOC(C[C@H]3O[C@H](CO)[C@H](O)[C@H](n4cc(-c5cc(F)c(F)c(F)c5)nn4)[C@H]3O)C2)ccn1 |
| InChI | InChI=1S/C24H24F3N5O6/c1-36-20-6-11(2-3-28-20)16-7-13(38-30-16)8-18-23(34)22(24(35)19(10-33)37-18)32-9-17(29-31-32)12-4-14(25)21(27)15(26)5-12/h2-6,9,13,18-19,22-24,33-35H,7-8,10H2,1H3/t13?,18-,19-,22-,23+,24+/m1/s1 |
| InChIKey | QKWMRJANFBDIGN-KKMMHKSMSA-N |
| XLogP | 1.37 |
| TPSA | 144.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.48 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|