C14H28S12 — CID 170692271
7-[1,3-dithian-4-ylsulfanyl(sulfanyl)methyl]sulfanyl-3,5-bis(sulfanylmethylsulfanyl)heptane-1,2,6-trithiol (PubChem CID 170692271) has the molecular formula C14H28S12 and a molecular weight of 581.18 g/mol. Its IUPAC name is 7-[1,3-dithian-4-ylsulfanyl(sulfanyl)methyl]sulfanyl-3,5-bis(sulfanylmethylsulfanyl)heptane-1,2,6-trithiol.
| Compound Name | 7-[1,3-dithian-4-ylsulfanyl(sulfanyl)methyl]sulfanyl-3,5-bis(sulfanylmethylsulfanyl)heptane-1,2,6-trithiol |
|---|---|
| PubChem CID | 170692271 |
| Molecular Formula | C14H28S12 |
| Molecular Weight | 581.18 g/mol |
| Exact Mass | 579.88 |
| IUPAC Name | 7-[1,3-dithian-4-ylsulfanyl(sulfanyl)methyl]sulfanyl-3,5-bis(sulfanylmethylsulfanyl)heptane-1,2,6-trithiol |
| SMILES | SCSC(CC(SCS)C(S)CSC(S)SC1CCSCS1)C(S)CS |
| InChI | InChI=1S/C14H28S12/c15-4-9(18)11(23-6-16)3-12(24-7-17)10(19)5-22-14(20)26-13-1-2-21-8-25-13/h9-20H,1-8H2 |
| InChIKey | VQTMMJFNPXYIHI-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.18 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|